CAS 30557-66-5 is the registry number for (±)-Evodone. Offered by: TRC. Available pack sizes: 1g.
3,6-dimethyl-6,7-dihydro-5H-1-benzofuran-4-one (CAS 30557-66-5) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: 3,6-dimethyl-6,7-dihydro-5H-1-benzofuran-4-one. InChIKey: SMUXTLISYBPIAU-UHFFFAOYSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | 3,6-dimethyl-6,7-dihydro-5H-1-benzofuran-4-one |
| InChIKey | SMUXTLISYBPIAU-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C(=CO2)C)C(=O)C1 |
Computed by PubChem (NCBI)