CAS 3055887-18-5 is the registry number for Gpr35 modulator 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-fluoro-N-[4-(phenylmethoxymethyl)phenyl]-5-(2H-triazolo[4,5-d]pyrimidin-5-yl)benzamide (CAS 3055887-18-5) is a chemical compound with the molecular formula C25H19FN6O2 and a molecular weight of 454.5 g/mol. IUPAC name: 2-fluoro-N-[4-(phenylmethoxymethyl)phenyl]-5-(2H-triazolo[4,5-d]pyrimidin-5-yl)benzamide. InChIKey: PMDAWXVIDUYSSU-UHFFFAOYSA-N.
| Molecular formula | C25H19FN6O2 |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | 2-fluoro-N-[4-(phenylmethoxymethyl)phenyl]-5-(2H-triazolo[4,5-d]pyrimidin-5-yl)benzamide |
| InChIKey | PMDAWXVIDUYSSU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCC2=CC=C(C=C2)NC(=O)C3=C(C=CC(=C3)C4=NC5=NNN=C5C=N4)F |
Computed by PubChem (NCBI)