CAS 3056-73-3 appears in our catalog under these names: N,3–Di(Phenyl)Prop–2–Enamide, N-Phenylcinnamamide, 95%, N,3-Diphenyl-2-propenamide, 95%(NMR),RG, 95%(NMR),RG. Offered by: GLPBio, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
(E)-N,3-diphenylprop-2-enamide (CAS 3056-73-3) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: (E)-N,3-diphenylprop-2-enamide. InChIKey: FIIZQHKGJMRJIL-VAWYXSNFSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | (E)-N,3-diphenylprop-2-enamide |
| InChIKey | FIIZQHKGJMRJIL-VAWYXSNFSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NC2=CC=CC=C2 |
Computed by PubChem (NCBI)