Products 3056083-14-5
CAS 3056083-14-5 is the registry number for Myt1-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-amino-4-(6,7-difluoro-1H-indazol-4-yl)-6-methyl-1H-1,7-phenanthrolin-2-one (CAS 3056083-14-5) is a chemical compound with the molecular formula C20H13F2N5O and a molecular weight of 377.3 g/mol. IUPAC name: 3-amino-4-(6,7-difluoro-1H-indazol-4-yl)-6-methyl-1H-1,7-phenanthrolin-2-one. InChIKey: SMHSNABIWLRGHW-UHFFFAOYSA-N.
| Molecular formula | C20H13F2N5O |
|---|---|
| Molecular weight | 377.3 g/mol |
| IUPAC name | 3-amino-4-(6,7-difluoro-1H-indazol-4-yl)-6-methyl-1H-1,7-phenanthrolin-2-one |
| InChIKey | SMHSNABIWLRGHW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=C1N=CC=C3)NC(=O)C(=C2C4=CC(=C(C5=C4C=NN5)F)F)N |
Computed by PubChem (NCBI)