CAS 3056559-92-0 is the registry number for DRP1 Allosteric-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-(dimethylamino)-2-phenylquinolin-6-yl]-2-methylpropanamide (CAS 3056559-92-0) is a chemical compound with the molecular formula C21H23N3O and a molecular weight of 333.4 g/mol. IUPAC name: N-[4-(dimethylamino)-2-phenylquinolin-6-yl]-2-methylpropanamide. InChIKey: VJKBXCPZDIMCOR-UHFFFAOYSA-N.
| Molecular formula | C21H23N3O |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | N-[4-(dimethylamino)-2-phenylquinolin-6-yl]-2-methylpropanamide |
| InChIKey | VJKBXCPZDIMCOR-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=CC2=C(C=C1)N=C(C=C2N(C)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)