CAS 3057-08-7 appears in our catalog under these names: 5,5-Dimethyl-2-phenoxy-1,3,2-dioxaphosph, orinane, 10 mg, 5,5-Dimethyl-2-phenoxy-1,3,2-dioxaphosph, orinane, 25 mg, 5,5-Dimethyl-2-phenoxy-1,3,2-dioxaphosph, orinane, 50 mg, 5,5-Dimethyl-2-phenoxy-1,3,2-dioxaphosph, orinane, 100 mg, 5,5-Dimethyl-2-phenoxy-1,3,2-dioxaphosph, orinane, 250 mg. Offered by: Roth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.
5,5-dimethyl-2-phenoxy-1,3,2-dioxaphosphinane (CAS 3057-08-7) is a chemical compound with the molecular formula C11H15O3P and a molecular weight of 226.21 g/mol. IUPAC name: 5,5-dimethyl-2-phenoxy-1,3,2-dioxaphosphinane. InChIKey: JSVDMQKVGLGYCM-UHFFFAOYSA-N.
| Molecular formula | C11H15O3P |
|---|---|
| Molecular weight | 226.21 g/mol |
| IUPAC name | 5,5-dimethyl-2-phenoxy-1,3,2-dioxaphosphinane |
| InChIKey | JSVDMQKVGLGYCM-UHFFFAOYSA-N |
| SMILES | CC1(COP(OC1)OC2=CC=CC=C2)C |
Computed by PubChem (NCBI)