CAS 30572-42-0 appears in our catalog under these names: ß-pBrPh-Glc/ 98.92% (existing batch purity), ß–pBrPh–Glc, ?-pBrPh-Glc, ß-pBrPh-Glc, 99.88%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
(2S,3R,4S,5S,6R)-2-(4-bromophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 30572-42-0) is a chemical compound with the molecular formula C12H15BrO6 and a molecular weight of 335.15 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-(4-bromophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: XKNTYHQVRMHDHY-RMPHRYRLSA-N.
| Molecular formula | C12H15BrO6 |
|---|---|
| Molecular weight | 335.15 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-(4-bromophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | XKNTYHQVRMHDHY-RMPHRYRLSA-N |
| SMILES | C1=CC(=CC=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)Br |
Computed by PubChem (NCBI)