CAS 3057263-82-5 is the registry number for CK1δ-IN-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine (CAS 3057263-82-5) is a chemical compound with the molecular formula C16H12FN5 and a molecular weight of 293.30 g/mol. IUPAC name: 4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine. InChIKey: KJAZOPPOBXTZKJ-UHFFFAOYSA-N.
| Molecular formula | C16H12FN5 |
|---|---|
| Molecular weight | 293.30 g/mol |
| IUPAC name | 4-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]-1H-pyrazolo[3,4-b]pyridine |
| InChIKey | KJAZOPPOBXTZKJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2=CC=C(C=C2)F)C3=C4C=NNC4=NC=C3 |
Computed by PubChem (NCBI)