CAS 3057531-75-3 is the registry number for PKR-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-(3,4-dichloro-1,2-thiazol-5-yl)-1,3-thiazol-2-yl]-5-(trichloromethyl)-1,3,4-oxadiazole (CAS 3057531-75-3) is a chemical compound with the molecular formula C9HCl5N4OS2 and a molecular weight of 422.5 g/mol. IUPAC name: 2-[4-(3,4-dichloro-1,2-thiazol-5-yl)-1,3-thiazol-2-yl]-5-(trichloromethyl)-1,3,4-oxadiazole. InChIKey: WJIJAUDCGUNCTC-UHFFFAOYSA-N.
| Molecular formula | C9HCl5N4OS2 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 2-[4-(3,4-dichloro-1,2-thiazol-5-yl)-1,3-thiazol-2-yl]-5-(trichloromethyl)-1,3,4-oxadiazole |
| InChIKey | WJIJAUDCGUNCTC-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)C2=NN=C(O2)C(Cl)(Cl)Cl)C3=C(C(=NS3)Cl)Cl |
Computed by PubChem (NCBI)