CAS 305799-73-9 is the registry number for 2-(2-Amino-5-iodophenyl)propan-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-(2-amino-5-iodophenyl)propan-2-ol (CAS 305799-73-9) is a chemical compound with the molecular formula C9H12INO and a molecular weight of 277.10 g/mol. IUPAC name: 2-(2-amino-5-iodophenyl)propan-2-ol. InChIKey: YSZYRQZSCYBIDI-UHFFFAOYSA-N.
| Molecular formula | C9H12INO |
|---|---|
| Molecular weight | 277.10 g/mol |
| IUPAC name | 2-(2-amino-5-iodophenyl)propan-2-ol |
| InChIKey | YSZYRQZSCYBIDI-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=CC(=C1)I)N)O |
Computed by PubChem (NCBI)