CAS 305808-24-6 appears in our catalog under these names: 2-Naphthyl phosphate calcium salt hydrate, 95%, Calcium 2-naphthylphosphate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 50g, 25g, 100g.
Calcium naphthalen-2-yl phosphate (CAS 305808-24-6) is a chemical compound with the molecular formula C10H7CaO4P and a molecular weight of 262.21 g/mol. IUPAC name: calcium naphthalen-2-yl phosphate. InChIKey: MPIBXADBMJKANU-UHFFFAOYSA-L.
| Molecular formula | C10H7CaO4P |
|---|---|
| Molecular weight | 262.21 g/mol |
| IUPAC name | calcium naphthalen-2-yl phosphate |
| InChIKey | MPIBXADBMJKANU-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C=C(C=CC2=C1)OP(=O)([O-])[O-].[Ca+2] |
Computed by PubChem (NCBI)