Products 305820-76-2
CAS 305820-76-2 is the registry number for PD173956. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2,6-dichlorophenyl)-2-(4-fluoroanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one (CAS 305820-76-2) is a chemical compound with the molecular formula C20H13Cl2FN4O and a molecular weight of 415.2 g/mol. IUPAC name: 6-(2,6-dichlorophenyl)-2-(4-fluoroanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one. InChIKey: ZSHRAUSJZQDIJR-UHFFFAOYSA-N.
| Molecular formula | C20H13Cl2FN4O |
|---|---|
| Molecular weight | 415.2 g/mol |
| IUPAC name | 6-(2,6-dichlorophenyl)-2-(4-fluoroanilino)-8-methylpyrido[2,3-d]pyrimidin-7-one |
| InChIKey | ZSHRAUSJZQDIJR-UHFFFAOYSA-N |
| SMILES | CN1C2=NC(=NC=C2C=C(C1=O)C3=C(C=CC=C3Cl)Cl)NC4=CC=C(C=C4)F |
Computed by PubChem (NCBI)