CAS 3058588-43-2 is the registry number for MS1172. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-fluoro-2-(propan-2-ylsulfonylamino)benzamide (CAS 3058588-43-2) is a chemical compound with the molecular formula C19H17BrFN3O3S2 and a molecular weight of 498.4 g/mol. IUPAC name: N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-fluoro-2-(propan-2-ylsulfonylamino)benzamide. InChIKey: VSQUOPYFDGLGCK-UHFFFAOYSA-N.
| Molecular formula | C19H17BrFN3O3S2 |
|---|---|
| Molecular weight | 498.4 g/mol |
| IUPAC name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-4-fluoro-2-(propan-2-ylsulfonylamino)benzamide |
| InChIKey | VSQUOPYFDGLGCK-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)NC1=C(C=CC(=C1)F)C(=O)NC2=NC(=CS2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)