CAS 3058588-52-3 is the registry number for XH161-180. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(cyclohexylsulfonylamino)-4-fluorobenzamide (CAS 3058588-52-3) is a chemical compound with the molecular formula C22H21BrFN3O3S2 and a molecular weight of 538.5 g/mol. IUPAC name: N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(cyclohexylsulfonylamino)-4-fluorobenzamide. InChIKey: ZLVRAOCCLBOEED-UHFFFAOYSA-N.
| Molecular formula | C22H21BrFN3O3S2 |
|---|---|
| Molecular weight | 538.5 g/mol |
| IUPAC name | N-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(cyclohexylsulfonylamino)-4-fluorobenzamide |
| InChIKey | ZLVRAOCCLBOEED-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)S(=O)(=O)NC2=C(C=CC(=C2)F)C(=O)NC3=NC(=CS3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)