CAS 3058943-53-3 is the registry number for FPR1 antagonist 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,2-bis(3-chlorophenyl)-N-(5-nitro-1,3-thiazol-2-yl)-3-oxopyrazolidine-4-carboxamide (CAS 3058943-53-3) is a chemical compound with the molecular formula C19H13Cl2N5O4S and a molecular weight of 478.3 g/mol. IUPAC name: 1,2-bis(3-chlorophenyl)-N-(5-nitro-1,3-thiazol-2-yl)-3-oxopyrazolidine-4-carboxamide. InChIKey: BSDJMHYJPWONRW-UHFFFAOYSA-N.
| Molecular formula | C19H13Cl2N5O4S |
|---|---|
| Molecular weight | 478.3 g/mol |
| IUPAC name | 1,2-bis(3-chlorophenyl)-N-(5-nitro-1,3-thiazol-2-yl)-3-oxopyrazolidine-4-carboxamide |
| InChIKey | BSDJMHYJPWONRW-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)N(N1C2=CC(=CC=C2)Cl)C3=CC(=CC=C3)Cl)C(=O)NC4=NC=C(S4)[N+](=O)[O-] |
Computed by PubChem (NCBI)