Products 3059765-69-1
CAS 3059765-69-1 is the registry number for 1,3-Bis(3,5-dimethylbenzyl)-1H-benzo[d]imidazol-3-ium chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1,3-bis[(3,5-dimethylphenyl)methyl]benzimidazol-3-ium chloride (CAS 3059765-69-1) is a chemical compound with the molecular formula C25H27ClN2 and a molecular weight of 390.9 g/mol. IUPAC name: 1,3-bis[(3,5-dimethylphenyl)methyl]benzimidazol-3-ium chloride. InChIKey: BTEVDAZTHYUKMH-UHFFFAOYSA-M.
| Molecular formula | C25H27ClN2 |
|---|---|
| Molecular weight | 390.9 g/mol |
| IUPAC name | 1,3-bis[(3,5-dimethylphenyl)methyl]benzimidazol-3-ium chloride |
| InChIKey | BTEVDAZTHYUKMH-UHFFFAOYSA-M |
| SMILES | CC1=CC(=CC(=C1)CN2C=[N+](C3=CC=CC=C32)CC4=CC(=CC(=C4)C)C)C.[Cl-] |
Computed by PubChem (NCBI)