Products 189298-48-4
CAS 189298-48-4 is the registry number for (R)-Meclizine. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(R)-(4-chlorophenyl)-phenylmethyl]-4-[(3-methylphenyl)methyl]piperazine (CAS 189298-48-4) is a chemical compound with the molecular formula C25H27ClN2 and a molecular weight of 390.9 g/mol. IUPAC name: 1-[(R)-(4-chlorophenyl)-phenylmethyl]-4-[(3-methylphenyl)methyl]piperazine. InChIKey: OCJYIGYOJCODJL-RUZDIDTESA-N.
| Molecular formula | C25H27ClN2 |
|---|---|
| Molecular weight | 390.9 g/mol |
| IUPAC name | 1-[(R)-(4-chlorophenyl)-phenylmethyl]-4-[(3-methylphenyl)methyl]piperazine |
| InChIKey | OCJYIGYOJCODJL-RUZDIDTESA-N |
| SMILES | CC1=CC(=CC=C1)CN2CCN(CC2)[C@H](C3=CC=CC=C3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)