CAS 306-92-3 appears in our catalog under these names: Perfluoro(methyldecalin), 95%, Perfluoro(methyldecalin), Flutec (TM) PP9 (Reg). Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 25g, 50g, 100g, 250g, 500g, 1000g, 1g.
1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-(trifluoromethyl)naphthalene (CAS 306-92-3) is a chemical compound with the molecular formula C11F20 and a molecular weight of 512.08 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-(trifluoromethyl)naphthalene. InChIKey: LWRNQOBXRHWPGE-UHFFFAOYSA-N.
| Molecular formula | C11F20 |
|---|---|
| Molecular weight | 512.08 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,7,8,8a-heptadecafluoro-8-(trifluoromethyl)naphthalene |
| InChIKey | LWRNQOBXRHWPGE-UHFFFAOYSA-N |
| SMILES | C12(C(C(C(C(C1(C(F)(F)F)F)(F)F)(F)F)(F)F)(C(C(C(C2(F)F)(F)F)(F)F)(F)F)F)F |
Computed by PubChem (NCBI)