Products 3061058-81-6
CAS 3061058-81-6 is the registry number for 1(R)-Tetrahydrocannabidiol. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylbenzene-1,3-diol (CAS 3061058-81-6) is a chemical compound with the molecular formula C21H34O2 and a molecular weight of 318.5 g/mol. IUPAC name: 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylbenzene-1,3-diol. InChIKey: LXIXAVCVBZBXIY-BPQIPLTHSA-N.
| Molecular formula | C21H34O2 |
|---|---|
| Molecular weight | 318.5 g/mol |
| IUPAC name | 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-5-pentylbenzene-1,3-diol |
| InChIKey | LXIXAVCVBZBXIY-BPQIPLTHSA-N |
| SMILES | CCCCCC1=CC(=C(C(=C1)O)[C@@H]2C[C@@H](CC[C@H]2C(C)C)C)O |
Computed by PubChem (NCBI)
Synonyms:
1(R)-Tetrahydrocannabidiol, orb3181737