Products 3063998-82-0
CAS 3063998-82-0 is the registry number for Rivastigmine impurity 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(1S)-1-[3-[ethyl(methyl)carbamoyl]oxyphenyl]ethyl]-trimethylazanium chloride (CAS 3063998-82-0) is a chemical compound with the molecular formula C15H25ClN2O2 and a molecular weight of 300.82 g/mol. IUPAC name: [(1S)-1-[3-[ethyl(methyl)carbamoyl]oxyphenyl]ethyl]-trimethylazanium chloride. InChIKey: QKUAWLCQYQLVJP-YDALLXLXSA-M.
| Molecular formula | C15H25ClN2O2 |
|---|---|
| Molecular weight | 300.82 g/mol |
| IUPAC name | [(1S)-1-[3-[ethyl(methyl)carbamoyl]oxyphenyl]ethyl]-trimethylazanium chloride |
| InChIKey | QKUAWLCQYQLVJP-YDALLXLXSA-M |
| SMILES | CCN(C)C(=O)OC1=CC=CC(=C1)[C@H](C)[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)