CAS 3066216-67-6 appears in our catalog under these names: DMT-TU, 98%, 98%, DMT-TU, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
[(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy-(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate (CAS 3066216-67-6) is a chemical compound with the molecular formula C10H18F6N5O3P and a molecular weight of 401.25 g/mol. IUPAC name: [(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy-(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate. InChIKey: SOIVAMGPWUBKJA-UHFFFAOYSA-N.
| Molecular formula | C10H18F6N5O3P |
|---|---|
| Molecular weight | 401.25 g/mol |
| IUPAC name | [(4,6-dimethoxy-1,3,5-triazin-2-yl)oxy-(dimethylamino)methylidene]-dimethylazanium hexafluorophosphate |
| InChIKey | SOIVAMGPWUBKJA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=[N+](C)C)OC1=NC(=NC(=N1)OC)OC.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)