CAS 30667-99-3 appears in our catalog under these names: 2,4'-Methoxychlor, 2,4'-Methoxychlor, Concentration: 10 µg/ml Solvent: Cyclohexane, 2,4'-Methoxychlor, Concentration: 100 µg/ml Solvent: Cyclohexane. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 1g, 10mg, 1x10ml, 1x1ml, 1x10mg.
1-methoxy-2-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]benzene (CAS 30667-99-3) is a chemical compound with the molecular formula C16H15Cl3O2 and a molecular weight of 345.6 g/mol. IUPAC name: 1-methoxy-2-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]benzene. InChIKey: KNLLPAOBVIKLDE-UHFFFAOYSA-N.
| Molecular formula | C16H15Cl3O2 |
|---|---|
| Molecular weight | 345.6 g/mol |
| IUPAC name | 1-methoxy-2-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]benzene |
| InChIKey | KNLLPAOBVIKLDE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2OC)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)