Products 3067202-14-3
CAS 3067202-14-3 is the registry number for ChREBPα/14-3-3 regulator-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-[2-[[2,2-difluoro-2-(3-fluorophenyl)ethyl]amino]-2-oxoethoxy]phenyl]phosphonic acid (CAS 3067202-14-3) is a chemical compound with the molecular formula C16H15F3NO5P and a molecular weight of 389.26 g/mol. IUPAC name: [2-[2-[[2,2-difluoro-2-(3-fluorophenyl)ethyl]amino]-2-oxoethoxy]phenyl]phosphonic acid. InChIKey: CWLSIOCFRIMBMV-UHFFFAOYSA-N.
| Molecular formula | C16H15F3NO5P |
|---|---|
| Molecular weight | 389.26 g/mol |
| IUPAC name | [2-[2-[[2,2-difluoro-2-(3-fluorophenyl)ethyl]amino]-2-oxoethoxy]phenyl]phosphonic acid |
| InChIKey | CWLSIOCFRIMBMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC(=O)NCC(C2=CC(=CC=C2)F)(F)F)P(=O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
ChREBP|A/14-3-3 regulator-1, orb2945581