CAS 306732-33-2 is the registry number for N-(3,5-bis(trifluoromethyl)phenyl)-2-(4-chlorophenylthio)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-chlorophenyl)sulfanylacetamide (CAS 306732-33-2) is a chemical compound with the molecular formula C16H10ClF6NOS and a molecular weight of 413.8 g/mol. IUPAC name: N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-chlorophenyl)sulfanylacetamide. InChIKey: ULGRQRBMPZLIDA-UHFFFAOYSA-N.
| Molecular formula | C16H10ClF6NOS |
|---|---|
| Molecular weight | 413.8 g/mol |
| IUPAC name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(4-chlorophenyl)sulfanylacetamide |
| InChIKey | ULGRQRBMPZLIDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1SCC(=O)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)Cl |
Computed by PubChem (NCBI)