Products 3067479-71-1

CAS 3067479-71-1 is the registry number for MyD88-IN-2, 99.42%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 5 mg, 10 mg, 25 mg.

Structural formula: {0} (CAS {1})

(2S)-1-(4-bromophenoxy)-3-[4-(1H-indol-2-ylmethyl)piperazin-1-yl]propan-2-ol (CAS 3067479-71-1) is a chemical compound with the molecular formula C22H26BrN3O2 and a molecular weight of 444.4 g/mol. IUPAC name: (2S)-1-(4-bromophenoxy)-3-[4-(1H-indol-2-ylmethyl)piperazin-1-yl]propan-2-ol. InChIKey: DBRPLQZOFYYYFY-FQEVSTJZSA-N.

Identity
Molecular formulaC22H26BrN3O2
Molecular weight444.4 g/mol
IUPAC name(2S)-1-(4-bromophenoxy)-3-[4-(1H-indol-2-ylmethyl)piperazin-1-yl]propan-2-ol
InChIKeyDBRPLQZOFYYYFY-FQEVSTJZSA-N
SMILESC1CN(CCN1CC2=CC3=CC=CC=C3N2)C[C@@H](COC4=CC=C(C=C4)Br)O

Computed by PubChem (NCBI)

Synonyms: MyD88-IN-2, orb2945765