Products 3068381-44-9
CAS 3068381-44-9 is the registry number for Methyl 4-amino-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%. Offered by: Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
Methyl 4-amino-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 3068381-44-9) is a chemical compound with the molecular formula C14H19BFNO4 and a molecular weight of 295.12 g/mol. IUPAC name: methyl 4-amino-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: NFBLXAWXRCRPCJ-UHFFFAOYSA-N.
| Molecular formula | C14H19BFNO4 |
|---|---|
| Molecular weight | 295.12 g/mol |
| IUPAC name | methyl 4-amino-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | NFBLXAWXRCRPCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2N)F)C(=O)OC |
Computed by PubChem (NCBI)