CAS 306935-63-7 is the registry number for 8-Phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline (CAS 306935-63-7) is a chemical compound with the molecular formula C14H8N4O and a molecular weight of 248.24 g/mol. IUPAC name: 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline. InChIKey: GJJKCCBTWZRCFD-UHFFFAOYSA-N.
| Molecular formula | C14H8N4O |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | 8-phenyl-[1,2,5]oxadiazolo[3,4-f]cinnoline |
| InChIKey | GJJKCCBTWZRCFD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C3C=CC4=NON=C4C3=C2 |
Computed by PubChem (NCBI)