Products 306935-93-3

CAS 306935-93-3 appears in our catalog under these names: 2,4-Di(tert-butoxy)pyrimidin-5-ylboronic acid hydrate, 97%, (2,4-Di-tert-butoxypyrimidin-5-yl)boronic acid hydrate 95%, 2,4-Di(tert-butoxy)pyrimidin-5-ylboronic acid hydrate, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

[2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidin-5-yl]boronic acid;hydrate (CAS 306935-93-3) is a chemical compound with the molecular formula C12H23BN2O5 and a molecular weight of 286.13 g/mol. IUPAC name: [2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidin-5-yl]boronic acid;hydrate. InChIKey: WNNMPLYQLSDLPS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23BN2O5
Molecular weight286.13 g/mol
IUPAC name[2,4-bis[(2-methylpropan-2-yl)oxy]pyrimidin-5-yl]boronic acid;hydrate
InChIKeyWNNMPLYQLSDLPS-UHFFFAOYSA-N
SMILESB(C1=CN=C(N=C1OC(C)(C)C)OC(C)(C)C)(O)O.O

Computed by PubChem (NCBI)