CAS 306935-99-9 is the registry number for 1–(4–Bromo–5–Chloro–2–Thienyl)–2–Chloroethan–1–One. Offered by: GLPBio. Available pack sizes: 1g.
1-(4-bromo-5-chlorothiophen-2-yl)-2-chloroethanone (CAS 306935-99-9) is a chemical compound with the molecular formula C6H3BrCl2OS and a molecular weight of 273.96 g/mol. IUPAC name: 1-(4-bromo-5-chlorothiophen-2-yl)-2-chloroethanone. InChIKey: INXFNQPLTWTZSX-UHFFFAOYSA-N.
| Molecular formula | C6H3BrCl2OS |
|---|---|
| Molecular weight | 273.96 g/mol |
| IUPAC name | 1-(4-bromo-5-chlorothiophen-2-yl)-2-chloroethanone |
| InChIKey | INXFNQPLTWTZSX-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Br)Cl)C(=O)CCl |
Computed by PubChem (NCBI)