CAS 306956-02-5 is the registry number for 2-Chloro-N-(2-methoxyphenyl)-5-nitrobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-N-(2-methoxyphenyl)-5-nitrobenzenesulfonamide (CAS 306956-02-5) is a chemical compound with the molecular formula C13H11ClN2O5S and a molecular weight of 342.76 g/mol. IUPAC name: 2-chloro-N-(2-methoxyphenyl)-5-nitrobenzenesulfonamide. InChIKey: FLXHOJUOKUHHEC-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O5S |
|---|---|
| Molecular weight | 342.76 g/mol |
| IUPAC name | 2-chloro-N-(2-methoxyphenyl)-5-nitrobenzenesulfonamide |
| InChIKey | FLXHOJUOKUHHEC-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NS(=O)(=O)C2=C(C=CC(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)