CAS 307-22-2 is the registry number for 1-Chloro-6h-dodecafluorohexane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane (CAS 307-22-2) is a chemical compound with the molecular formula C6HClF12 and a molecular weight of 336.50 g/mol. IUPAC name: 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane. InChIKey: LENGESQCMOBFEV-UHFFFAOYSA-N.
| Molecular formula | C6HClF12 |
|---|---|
| Molecular weight | 336.50 g/mol |
| IUPAC name | 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane |
| InChIKey | LENGESQCMOBFEV-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(F)(F)Cl)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)