CAS 307-26-6 is the registry number for 1,1,3,5,6-Pentachlorononafluorohexane, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1,1,3,5,6-pentachloro-1,2,2,3,4,4,5,6,6-nonafluorohexane (CAS 307-26-6) is a chemical compound with the molecular formula C6Cl5F9 and a molecular weight of 420.3 g/mol. IUPAC name: 1,1,3,5,6-pentachloro-1,2,2,3,4,4,5,6,6-nonafluorohexane. InChIKey: DVAVTWDOWVBESE-UHFFFAOYSA-N.
| Molecular formula | C6Cl5F9 |
|---|---|
| Molecular weight | 420.3 g/mol |
| IUPAC name | 1,1,3,5,6-pentachloro-1,2,2,3,4,4,5,6,6-nonafluorohexane |
| InChIKey | DVAVTWDOWVBESE-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(Cl)Cl)(F)F)(F)Cl)(C(C(F)(F)Cl)(F)Cl)(F)F |
Computed by PubChem (NCBI)