CAS 307-29-9 is the registry number for 1H,1H-Perfluorooctylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-amine (CAS 307-29-9) is a chemical compound with the molecular formula C8H4F15N and a molecular weight of 399.10 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-amine. InChIKey: HZCZXRSVKNFILZ-UHFFFAOYSA-N.
| Molecular formula | C8H4F15N |
|---|---|
| Molecular weight | 399.10 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-amine |
| InChIKey | HZCZXRSVKNFILZ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)N |
Computed by PubChem (NCBI)