CAS 307-30-2 appears in our catalog under these names: 1H,1H-Pentadecafluoro-1-octanol, 98%, 1H,1H–Pentadecafluoro–1–octanol, 1H,1H-Perfluoro-1-octanol, 98%, 1H,1h-pentadecafluoro-1-octanol 98%, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-PENTADECA&. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 5g, 1g, 250mg.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol (CAS 307-30-2) is a chemical compound with the molecular formula C8H3F15O and a molecular weight of 400.08 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol. InChIKey: PJDOLCGOTSNFJM-UHFFFAOYSA-N.
| Molecular formula | C8H3F15O |
|---|---|
| Molecular weight | 400.08 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-ol |
| InChIKey | PJDOLCGOTSNFJM-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)