CAS 307-31-3 is the registry number for Perfluorooctanamidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanimidamide (CAS 307-31-3) is a chemical compound with the molecular formula C8H3F15N2 and a molecular weight of 412.10 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanimidamide. InChIKey: VHJKOLAKAFYZMC-UHFFFAOYSA-N.
| Molecular formula | C8H3F15N2 |
|---|---|
| Molecular weight | 412.10 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanimidamide |
| InChIKey | VHJKOLAKAFYZMC-UHFFFAOYSA-N |
| SMILES | C(=N)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)N |
Computed by PubChem (NCBI)