CAS 307-51-7 is the registry number for Perfluorodecanesulfonyl Fluoride. Offered by: TRC. Available pack sizes: 100mg.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonyl fluoride (CAS 307-51-7) is a chemical compound with the molecular formula C10F22O2S and a molecular weight of 602.14 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonyl fluoride. InChIKey: QMNUYVWNQITPHA-UHFFFAOYSA-N.
| Molecular formula | C10F22O2S |
|---|---|
| Molecular weight | 602.14 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane-1-sulfonyl fluoride |
| InChIKey | QMNUYVWNQITPHA-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(F)(F)S(=O)(=O)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)