CAS 307-59-5 appears in our catalog under these names: Perfluorododecane, Hexacosafluorododecane, Perfluorododecane, 97%. Offered by: Dr. Ehrenstorfer, GLPBio, Biosynth, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 2000mg, 5000mg, 10000mg, 250mg.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosafluorododecane (CAS 307-59-5) is a chemical compound with the molecular formula C12F26 and a molecular weight of 638.09 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosafluorododecane. InChIKey: WNZGTRLARPEMIG-UHFFFAOYSA-N.
| Molecular formula | C12F26 |
|---|---|
| Molecular weight | 638.09 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosafluorododecane |
| InChIKey | WNZGTRLARPEMIG-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)