CAS 307-60-8 appears in our catalog under these names: Perfluorododecyl iodide, 95%, Perfluorododecyl Iodide, PERFLUORODODECYL IODIDE, 97%. Offered by: Combi-blocks, TRC, Sigma-Aldrich. Available pack sizes: 25g, 5g, 1g, 10mg, 1mg.
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodododecane (CAS 307-60-8) is a chemical compound with the molecular formula C12F25I and a molecular weight of 745.99 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodododecane. InChIKey: WBYCUETVRCXUPE-UHFFFAOYSA-N.
| Molecular formula | C12F25I |
|---|---|
| Molecular weight | 745.99 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12-pentacosafluoro-12-iodododecane |
| InChIKey | WBYCUETVRCXUPE-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(F)(F)I)(F)F)(F)F)(F)F)(F)F)(F)F)(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)