CAS 307-77-7 is the registry number for Perfluorosebacamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide (CAS 307-77-7) is a chemical compound with the molecular formula C10H4F16N2O2 and a molecular weight of 488.12 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide. InChIKey: FWBPSSMCLDHZRS-UHFFFAOYSA-N.
| Molecular formula | C10H4F16N2O2 |
|---|---|
| Molecular weight | 488.12 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanediamide |
| InChIKey | FWBPSSMCLDHZRS-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(C(C(C(C(=O)N)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)N |
Computed by PubChem (NCBI)