CAS 307-99-3 is the registry number for 1H,8H-Perfluorooctane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane (CAS 307-99-3) is a chemical compound with the molecular formula C8H2F16 and a molecular weight of 402.08 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane. InChIKey: JCRVQXKRULILSR-UHFFFAOYSA-N.
| Molecular formula | C8H2F16 |
|---|---|
| Molecular weight | 402.08 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane |
| InChIKey | JCRVQXKRULILSR-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)