CAS 3071-70-3 appears in our catalog under these names: S 0268 - FEW Chemicals, 760 nm in MeOH, 10 g, plastic, 3,3'-Diethylthiatricarbocyanine iodide, 98%, DTTCI, 98%, DTTCI, 3,3'-Diethylthiatricarbocyanine Iodide, >98.0%(N). Offered by: Roth, Combi-blocks, AmBeed, GLPBio, TCI. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg, 500 mg, 250 mg.
(2Z)-3-ethyl-2-[(2E,4E,6E)-7-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzothiazole iodide (CAS 3071-70-3) is a chemical compound with the molecular formula C25H25IN2S2 and a molecular weight of 544.5 g/mol. IUPAC name: (2Z)-3-ethyl-2-[(2E,4E,6E)-7-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzothiazole iodide. InChIKey: OYVFJKVYVDYPFV-UHFFFAOYSA-M.
| Molecular formula | C25H25IN2S2 |
|---|---|
| Molecular weight | 544.5 g/mol |
| IUPAC name | (2Z)-3-ethyl-2-[(2E,4E,6E)-7-(3-ethyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-1,3-benzothiazole iodide |
| InChIKey | OYVFJKVYVDYPFV-UHFFFAOYSA-M |
| SMILES | CCN\1C2=CC=CC=C2S/C1=C\C=C\C=C\C=C\C3=[N+](C4=CC=CC=C4S3)CC.[I-] |
Computed by PubChem (NCBI)