Products 3073645-31-2
CAS 3073645-31-2 is the registry number for 2-Nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine (CAS 3073645-31-2) is a chemical compound with the molecular formula C11H16BN3O4 and a molecular weight of 265.08 g/mol. IUPAC name: 2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine. InChIKey: LRQSPHPKKWDDHW-UHFFFAOYSA-N.
| Molecular formula | C11H16BN3O4 |
|---|---|
| Molecular weight | 265.08 g/mol |
| IUPAC name | 2-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine |
| InChIKey | LRQSPHPKKWDDHW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)