CAS 1353762-30-7 is the registry number for 5-Nitro-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 1353762-30-7) is a chemical compound with the molecular formula C11H16BN3O4 and a molecular weight of 265.08 g/mol. IUPAC name: 5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: RZZBZVXUOALMBY-UHFFFAOYSA-N.
| Molecular formula | C11H16BN3O4 |
|---|---|
| Molecular weight | 265.08 g/mol |
| IUPAC name | 5-nitro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | RZZBZVXUOALMBY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2N)[N+](=O)[O-] |
Computed by PubChem (NCBI)