CAS 3074-00-8 appears in our catalog under these names: 6H-Benzo[cd]pyren-6-one, 97%, 6H-Benzo(cd)pyren-6-one, 77681, 6H-Benzo(cd)pyren-6-one (purity). Offered by: Chemat Brand, TRC, Sigma-Aldrich. Available pack sizes: on request, 100mg, 1g, 10MG.
Pentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1,3,5(18),6,8(17),9,11(16),12,14-nonaen-19-one (CAS 3074-00-8) is a chemical compound with the molecular formula C19H10O and a molecular weight of 254.3 g/mol. IUPAC name: pentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1,3,5(18),6,8(17),9,11(16),12,14-nonaen-19-one. InChIKey: CLIKSBRDCNSYNO-UHFFFAOYSA-N.
| Molecular formula | C19H10O |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | pentacyclo[13.3.1.05,18.08,17.011,16]nonadeca-1,3,5(18),6,8(17),9,11(16),12,14-nonaen-19-one |
| InChIKey | CLIKSBRDCNSYNO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)C4=CC=CC5=C4C3=C(C=C2)C=C5 |
Computed by PubChem (NCBI)