CAS 307521-00-2 is the registry number for 2–(3,4–Bis(benzyloxy)phenyl)–3–hydroxy–4H–chromen–4–one. Offered by: GLPBio. Available pack sizes: 100mg.
2-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxychromen-4-one (CAS 307521-00-2) is a chemical compound with the molecular formula C29H22O5 and a molecular weight of 450.5 g/mol. IUPAC name: 2-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxychromen-4-one. InChIKey: LVTHPNVNUFJGCA-UHFFFAOYSA-N.
| Molecular formula | C29H22O5 |
|---|---|
| Molecular weight | 450.5 g/mol |
| IUPAC name | 2-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxychromen-4-one |
| InChIKey | LVTHPNVNUFJGCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C3=C(C(=O)C4=CC=CC=C4O3)O)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)