CAS 307531-80-2 appears in our catalog under these names: 2,6–DICHLOROBENZYLZINC CHLORIDE, 2,6-DICHLOROBENZYLZINC CHLORIDE, 0.5M &. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 100ml, 25ml, 50ML.
Chlorozinc(1+);1,3-dichloro-2-methanidylbenzene (CAS 307531-80-2) is a chemical compound with the molecular formula C7H5Cl3Zn and a molecular weight of 260.8 g/mol. IUPAC name: chlorozinc(1+);1,3-dichloro-2-methanidylbenzene. InChIKey: TXXQINBXYHNHIM-UHFFFAOYSA-M.
| Molecular formula | C7H5Cl3Zn |
|---|---|
| Molecular weight | 260.8 g/mol |
| IUPAC name | chlorozinc(1+);1,3-dichloro-2-methanidylbenzene |
| InChIKey | TXXQINBXYHNHIM-UHFFFAOYSA-M |
| SMILES | [CH2-]C1=C(C=CC=C1Cl)Cl.Cl[Zn+] |
Computed by PubChem (NCBI)