Products 307532-04-3
CAS 307532-04-3 appears in our catalog under these names: (2R)-1-Chloro-3-(4-fluorophenoxy)-2-propanol, (R)-(+)-1-Chloro-3-(4-fluorophenoxy)-2-p. Offered by: Chemat, Sigma-Aldrich. Available pack sizes: 5g.
(2R)-1-chloro-3-(4-fluorophenoxy)propan-2-ol (CAS 307532-04-3) is a chemical compound with the molecular formula C9H10ClFO2 and a molecular weight of 204.62 g/mol. IUPAC name: (2R)-1-chloro-3-(4-fluorophenoxy)propan-2-ol. InChIKey: OSIKOYZBGUHWAB-QMMMGPOBSA-N.
| Molecular formula | C9H10ClFO2 |
|---|---|
| Molecular weight | 204.62 g/mol |
| IUPAC name | (2R)-1-chloro-3-(4-fluorophenoxy)propan-2-ol |
| InChIKey | OSIKOYZBGUHWAB-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1OC[C@H](CCl)O)F |
Computed by PubChem (NCBI)