CAS 3075607-57-4 is the registry number for Antifungal agent 136, 99.60%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 50 mg, 25 mg, 5 mg, 100 mg, 10mM/1mL.
(2R,3R)-2-(2,4-difluorophenyl)-3-(3-pyridin-4-ylpropyldisulfanyl)-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 3075607-57-4) is a chemical compound with the molecular formula C20H22F2N4OS2 and a molecular weight of 436.5 g/mol. IUPAC name: (2R,3R)-2-(2,4-difluorophenyl)-3-(3-pyridin-4-ylpropyldisulfanyl)-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: DGCZAJWNPYKHHR-FOIQADDNSA-N.
| Molecular formula | C20H22F2N4OS2 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | (2R,3R)-2-(2,4-difluorophenyl)-3-(3-pyridin-4-ylpropyldisulfanyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | DGCZAJWNPYKHHR-FOIQADDNSA-N |
| SMILES | C[C@H]([C@](CN1C=NC=N1)(C2=C(C=C(C=C2)F)F)O)SSCCCC3=CC=NC=C3 |
Computed by PubChem (NCBI)