Products 3075750-60-3
CAS 3075750-60-3 is the registry number for Keap1-Nrf2-IN-28. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-fluoro-N-[2-(4-methoxyphenyl)-4-oxochromen-7-yl]benzenesulfonamide (CAS 3075750-60-3) is a chemical compound with the molecular formula C22H16FNO5S and a molecular weight of 425.4 g/mol. IUPAC name: 4-fluoro-N-[2-(4-methoxyphenyl)-4-oxochromen-7-yl]benzenesulfonamide. InChIKey: KWCUNVGUQPKBAS-UHFFFAOYSA-N.
| Molecular formula | C22H16FNO5S |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | 4-fluoro-N-[2-(4-methoxyphenyl)-4-oxochromen-7-yl]benzenesulfonamide |
| InChIKey | KWCUNVGUQPKBAS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3)NS(=O)(=O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)
Synonyms:
Keap1-Nrf2-IN-28, orb3028015