CAS 3075751-32-2 appears in our catalog under these names: 5,7-Dichloro-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4(3H)-one, 98%, 98%, 5,7-Dichloro-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4(3H)-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
5,7-dichloro-8-fluoro-2-methoxy-3H-pyrido[4,3-d]pyrimidin-4-one (CAS 3075751-32-2) is a chemical compound with the molecular formula C8H4Cl2FN3O2 and a molecular weight of 264.04 g/mol. IUPAC name: 5,7-dichloro-8-fluoro-2-methoxy-3H-pyrido[4,3-d]pyrimidin-4-one. InChIKey: VAPCBRZGZCHVKT-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2FN3O2 |
|---|---|
| Molecular weight | 264.04 g/mol |
| IUPAC name | 5,7-dichloro-8-fluoro-2-methoxy-3H-pyrido[4,3-d]pyrimidin-4-one |
| InChIKey | VAPCBRZGZCHVKT-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C(=O)N1)C(=NC(=C2F)Cl)Cl |
Computed by PubChem (NCBI)